Unverified Commit 87c4184a authored by Gao, Xiang's avatar Gao, Xiang Committed by GitHub
Browse files

add style check to unit test (#12)

parent a61a1b3e
FROM zasdfgbnm/pytorch-master
RUN pacman -Sy --noconfirm python-sphinx python2-sphinx
RUN pacman -Sy --noconfirm python-sphinx python2-sphinx flake8
COPY . /torchani
RUN cd torchani && pip install .
RUN cd torchani && pip2 install .
from benchmark import Benchmark
import torchani
class ANIBenchmark(Benchmark):
def __init__(self, device):
super(ANIBenchmark, self).__init__(device)
self.aev_computer = torchani.SortedAEV(device=device)
self.model = torchani.ModelOnAEV(
self.aev_computer, benchmark=True, derivative=True, from_nc=None)
def oneByOne(self, coordinates, species):
conformations = coordinates.shape[0]
coordinates = coordinates.to(self.device)
for i in range(conformations):
c = coordinates[i:i+1, :, :]
self.model(c, species)
ret = {
'aev': self.model.timers['aev'],
'energy': self.model.timers['nn'],
'force': self.model.timers['derivative']
}
self.model.reset_timers()
return ret
def inBatch(self, coordinates, species):
coordinates = coordinates.to(self.device)
self.model(coordinates, species)
ret = {
'aev': self.model.timers['aev'],
'energy': self.model.timers['nn'],
'force': self.model.timers['derivative']
}
self.model.reset_timers()
return ret
import numpy
import torchani
class Benchmark:
"""Abstract class for benchmarking ANI implementations"""
class ANIBenchmark:
def __init__(self, device):
self.device = device
super(ANIBenchmark, self).__init__(device)
self.aev_computer = torchani.SortedAEV(device=device)
self.model = torchani.ModelOnAEV(
self.aev_computer, benchmark=True, derivative=True, from_nc=None)
def oneByOne(self, coordinates, species):
"""Benchmarking the given dataset of computing energies and forces one at a time
Parameters
----------
coordinates : numpy.ndarray
Array of shape (conformations, atoms, 3)
species : list
List of species for this molecule. The length of the list must be the same as
atoms in the molecule.
Returns
-------
dict
Dictionary storing the times for computing AEVs, energies and forces, in seconds.
The dictionary should contain the following keys:
aev : the time used to compute AEVs from coordinates with given neighbor list.
energy : the time used to compute energies, when the AEVs are given.
force : the time used to compute forces, when the energies and AEVs are given.
"""
# return { 'neighborlist': 0, 'aev': 0, 'energy': 0, 'force': 0 }
raise NotImplementedError('subclass must implement this method')
conformations = coordinates.shape[0]
coordinates = coordinates.to(self.device)
for i in range(conformations):
c = coordinates[i:i+1, :, :]
self.model(c, species)
ret = {
'aev': self.model.timers['aev'],
'energy': self.model.timers['nn'],
'force': self.model.timers['derivative']
}
self.model.reset_timers()
return ret
def inBatch(self, coordinates, species):
"""Benchmarking the given dataset of computing energies and forces in batch mode
The signature of this function is the same as `oneByOne`"""
# return { 'neighborlist': 0, 'aev': 0, 'energy': 0, 'force': 0 }
raise NotImplementedError('subclass must implement this method')
coordinates = coordinates.to(self.device)
self.model(coordinates, species)
ret = {
'aev': self.model.timers['aev'],
'energy': self.model.timers['nn'],
'force': self.model.timers['derivative']
}
self.model.reset_timers()
return ret
......@@ -2,7 +2,6 @@ from ase import Atoms
from ase.calculators.tip3p import TIP3P, rOH, angleHOH
from ase.md import Langevin
import ase.units as units
from ase.io.trajectory import Trajectory
import numpy
import h5py
from rdkit import Chem
......@@ -10,14 +9,12 @@ from rdkit.Chem import AllChem
# from asap3 import EMT
from ase.calculators.emt import EMT
from multiprocessing import Pool
from tqdm import tqdm, tqdm_notebook, trange
tqdm.monitor_interval = 0
from tqdm import tqdm, trange
from selected_system import mols, mol_file
import functools
conformations = 1024
T = 30
tqdm.monitor_interval = 0
fw = h5py.File("waters.hdf5", "w")
fm = h5py.File(mol_file, "w")
......@@ -96,7 +93,7 @@ if __name__ == '__main__':
print('done with molecules')
with Pool() as p:
p.starmap(waterbox, [(10, 10, 10, 0), (20, 20, 10,
1), (30, 30, 30, 2), (40, 40, 40, 3)])
p.starmap(waterbox, [(10, 10, 10, 0), (20, 20, 10, 1),
(30, 30, 30, 2), (40, 40, 40, 3)])
print(list(fw.keys()))
print('done with water boxes')
mols = {
'20': [
'COC(=O)c1ccc([N+](=O)[O-])cc1',
'O=c1nnc2ccccc2n1CO',
'CCc1ccc([N+](=O)[O-])cc1',
'Nc1ccc(c2cnco2)cc1',
'COc1ccc(N)c(N)c1',
'O=C(O)CNc1ccccc1',
'NC(=O)NNc1ccccc1',
'Cn1c(=O)oc(=O)c2ccccc12',
'CC(=O)Nc1ccc(O)cc1',
'COc1ccc(CC#N)cc1'
],
'50': [
'O=[N+]([O-])c1ccc(NN=Cc2ccc(C=NNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)c([N+](=O)[O-])c1',
'CCCCCc1nccnc1OCC(C)(C)CC(C)C',
'CC(C)(C)c1ccc(N(C(=O)c2ccccc2)C(C)(C)C)cc1',
'CCCCCCCCCCCOC(=O)Nc1ccccc1',
'CC(=O)NCC(CN1CCCC1)(c1ccccc1)c1ccccc1',
'CCCCCc1cnc(C)c(OCC(C)(C)CCC)n1',
'CCCCCCCCCCCCN1CCOC(=O)C1',
'CCCCOc1ccc(C=Nc2ccc(CCCC)cc2)cc1',
'CC1CC(C)C(=NNC(=O)N)C(C(O)CC2CC(=O)NC(=O)C2)C1',
'CCCCCOc1ccc(C=Nc2ccc(C(=O)OCC)cc2)cc1'
],
'10': [
'N#CCC(=O)N',
'N#CCCO',
'O=C1NC(=O)C(=O)N1',
'COCC#N',
'N#CCNC=O',
'ON=CC=NO',
'NCC(=O)O',
'NC(=O)CO',
'N#Cc1ccco1',
'C=CC(=O)N'
],
'4,5,6': [
'C',
'C#CC#N',
'C=C',
'CC#N',
'C#CC#C',
'O=CC#C',
'C#C'
],
'100': [
'CC(C)C[C@@H](C(=O)O)NC(=O)C[C@@H]([C@H](CC1CCCCC1)NC(=O)CC[C@@H]([C@H](Cc2ccccc2)NC(=O)OC(C)(C)C)O)O',
'CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@@H](CN[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc3ccccc3)C(=O)N)O',
'CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@H](CN[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc3ccccc3)C(=O)N)O',
'CC[C@H](c1ccc(cc1)O)[C@H](c2ccc(cc2)O)C(=O)OCCCCCCCCOC(=O)C(c3ccc(cc3)O)C(CC)c4ccc(cc4)O',
'CC/C(=C\\CC[C@H](C)C[C@@H](C)CC[C@@H]([C@H](C)C(=O)C[C@H]([C@H](C)[C@@H](C)OC(=O)C[C@H](/C(=C(\\C)/C(=O)O)/C(=O)O)O)O)O)/C=C/C(=O)O',
'CC[C@H](C)[C@H]1C(=O)NCCCOc2ccc(cc2)C[C@@H](C(=O)N1)NC(=O)[C@@H]3Cc4ccc(cc4)OCCCCC(=O)N[C@H](C(=O)N3)C(C)C',
'CC(C)(C)CC(C)(C)c1ccc(cc1)OCCOCCOCCOCCOCCOCCOCCOCCOCCO',
'CCOC(=O)CC[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCc3ccccc3',
'C[C@]12CC[C@@H]3c4ccc(cc4CC[C@H]3[C@@H]1C[C@@H]([C@@H]2O)CCCCCCCCC(=O)OC[C@@H]5[C@H]([C@H]([C@@H](O5)n6cnc7c6ncnc7N)O)O)O',
'c1cc(ccc1CCc2c[nH]c3c2C(=O)NC(=N3)N)C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)N[C@H](CCC(=O)O)C(=O)O)C(=O)O)C(=O)O)C(=O)O'
],
'305': [
'[H]/N=C(/N)\\NCCC[C@H](C(=O)N[C@H]([C@@H](C)O)C(=O)N[C@H](Cc1ccc(cc1)O)C(=O)NCCCC[C@@H](C(=O)NCCCC[C@@H](C(=O)NCC(=O)O)NC(=O)[C@H](CCCCNC(=O)[C@@H](Cc2ccc(cc2)O)NC(=O)[C@@H]([C@@H](C)O)NC(=O)[C@@H](CCCN/C(=N\\[H])/N)N)NC(=O)[C@@H](Cc3ccc(cc3)O)NC(=O)[C@@H]([C@@H](C)O)NC(=O)[C@@H](CCCN/C(=N\\[H])/N)N)NC(=O)[C@@H](Cc4ccc(cc4)O)NC(=O)[C@@H]([C@@H](C)O)NC(=O)[C@@H](CCCN/C(=N\\[H])/N)N)N'
]
}
mol_file = "molecules.hdf5"
from selected_system import mols, mol_file
import h5py
import os
fm = h5py.File(os.path.join(mol_file), "r")
for i in mols:
print('number of atoms:', i)
smiles = mols[i]
for s in smiles:
key = s.replace('/', '_')
filename = i
with open('benchmark_xyz/' + filename + '.xyz', 'w') as fxyz:
coordinates = fm[key][()]
species = fm[key].attrs['species'].split()
conformations = coordinates.shape[0]
atoms = len(species)
for i in range(conformations):
fxyz.write('{}\n{}\n'.format(
atoms, 'smiles:{}\tconformation:{}'.format(s, i)))
for j in range(atoms):
ss = species[j]
xyz = coordinates[i, j, :]
x = xyz[0]
y = xyz[1]
z = xyz[2]
fxyz.write('{} {} {} {}\n'.format(ss, x, y, z))
break
......@@ -10,4 +10,5 @@ steps:
unit-tests:
image: '${{build-torchani}}'
commands:
- flake8
- python setup.py test
\ No newline at end of file
......@@ -3,14 +3,11 @@ import torchani
import torchani.data
import math
import timeit
import itertools
import os
import sys
import pickle
from tensorboardX import SummaryWriter
from tqdm import tqdm
from common import *
import sys
from common import get_or_create_model, Averager, evaluate
import json
chunk_size = 256
......@@ -27,11 +24,14 @@ with open('data/dataset.dat', 'rb') as f:
testing, chunk_size, batch_chunks)
training_dataloader = torch.utils.data.DataLoader(
training, batch_sampler=training_sampler, collate_fn=torchani.data.collate)
training, batch_sampler=training_sampler,
collate_fn=torchani.data.collate)
validation_dataloader = torch.utils.data.DataLoader(
validation, batch_sampler=validation_sampler, collate_fn=torchani.data.collate)
validation, batch_sampler=validation_sampler,
collate_fn=torchani.data.collate)
testing_dataloader = torch.utils.data.DataLoader(
testing, batch_sampler=testing_sampler, collate_fn=torchani.data.collate)
testing, batch_sampler=testing_sampler,
collate_fn=torchani.data.collate)
writer = SummaryWriter('runs/adam-{}'.format(sys.argv[1]))
......@@ -48,8 +48,8 @@ def subset_rmse(subset_dataloader):
for molecule_id in batch:
_species = subset_dataloader.dataset.species[molecule_id]
coordinates, energies = batch[molecule_id]
coordinates = coordinates.to(aev_computer.device)
energies = energies.to(aev_computer.device)
coordinates = coordinates.to(model.aev_computer.device)
energies = energies.to(model.aev_computer.device)
count, squared_error = evaluate(
model, coordinates, energies, _species)
squared_error = squared_error.item()
......@@ -73,13 +73,15 @@ best_validation_rmse = math.inf
best_epoch = 0
start = timeit.default_timer()
while True:
for batch in tqdm(training_dataloader, desc='epoch {}'.format(epoch), total=len(training_sampler)):
for batch in tqdm(training_dataloader,
desc='epoch {}'.format(epoch),
total=len(training_sampler)):
a = Averager()
for molecule_id in batch:
_species = training.species[molecule_id]
coordinates, energies = batch[molecule_id]
coordinates = coordinates.to(aev_computer.device)
energies = energies.to(aev_computer.device)
coordinates = coordinates.to(model.aev_computer.device)
energies = energies.to(model.aev_computer.device)
count, squared_error = evaluate(
model, coordinates, energies, _species)
a.add(count, squared_error / len(_species))
......
......@@ -3,14 +3,10 @@ import torchani
import torchani.data
import math
import timeit
import itertools
import os
import sys
import pickle
from tensorboardX import SummaryWriter
from tqdm import tqdm
from common import *
from copy import deepcopy
from common import get_or_create_model, Averager, evaluate
chunk_size = 256
batch_chunks = 1024 // chunk_size
......@@ -26,11 +22,14 @@ with open('data/dataset.dat', 'rb') as f:
testing, chunk_size, batch_chunks)
training_dataloader = torch.utils.data.DataLoader(
training, batch_sampler=training_sampler, collate_fn=torchani.data.collate)
training, batch_sampler=training_sampler,
collate_fn=torchani.data.collate)
validation_dataloader = torch.utils.data.DataLoader(
validation, batch_sampler=validation_sampler, collate_fn=torchani.data.collate)
validation, batch_sampler=validation_sampler,
collate_fn=torchani.data.collate)
testing_dataloader = torch.utils.data.DataLoader(
testing, batch_sampler=testing_sampler, collate_fn=torchani.data.collate)
testing, batch_sampler=testing_sampler,
collate_fn=torchani.data.collate)
writer = SummaryWriter()
......@@ -47,8 +46,8 @@ def subset_rmse(subset_dataloader):
for molecule_id in batch:
_species = subset_dataloader.dataset.species[molecule_id]
coordinates, energies = batch[molecule_id]
coordinates = coordinates.to(aev_computer.device)
energies = energies.to(aev_computer.device)
coordinates = coordinates.to(model.aev_computer.device)
energies = energies.to(model.aev_computer.device)
count, squared_error = evaluate(coordinates, energies, _species)
squared_error = squared_error.item()
a.add(count, squared_error)
......@@ -71,13 +70,14 @@ best_validation_rmse = math.inf
best_epoch = 0
start = timeit.default_timer()
while True:
for batch in tqdm(training_dataloader, desc='epoch {}'.format(epoch), total=len(training_sampler)):
for batch in tqdm(training_dataloader, desc='epoch {}'.format(epoch),
total=len(training_sampler)):
a = Averager()
for molecule_id in batch:
_species = training.species[molecule_id]
coordinates, energies = batch[molecule_id]
coordinates = coordinates.to(aev_computer.device)
energies = energies.to(aev_computer.device)
coordinates = coordinates.to(model.aev_computer.device)
energies = energies.to(model.aev_computer.device)
count, squared_error = evaluate(
model, coordinates, energies, _species)
a.add(count, squared_error / len(_species))
......
......@@ -23,7 +23,8 @@ hyperparams = [ # (chunk size, batch chunks)
]
for chunk_size, batch_chunks in hyperparams:
with open('data/avg-{}-{}.dat'.format(chunk_size, batch_chunks), 'rb') as f:
with open('data/avg-{}-{}.dat'.format(chunk_size, batch_chunks),
'rb') as f:
ag, agsqr = pickle.load(f)
variance = torch.sum(agsqr) - torch.sum(ag**2)
stddev = torch.sqrt(variance).item()
......
......@@ -3,18 +3,16 @@ import torch
import torchani
import configs
import torchani.data
import math
from tqdm import tqdm
import itertools
import os
import pickle
from common import get_or_create_model, Averager, evaluate
device = configs.device
if len(sys.argv) >= 2:
configs.device = torch.device(sys.argv[1])
from common import *
device = torch.device(sys.argv[1])
ds = torchani.data.load_dataset(configs.data_path)
model = get_or_create_model('/tmp/model.pt', device=device)
# just to conveniently zero grads
optimizer = torch.optim.Adam(model.parameters())
......@@ -31,8 +29,8 @@ def batch_gradient(batch):
for molecule_id in batch:
_species = ds.species[molecule_id]
coordinates, energies = batch[molecule_id]
coordinates = coordinates.to(aev_computer.device)
energies = energies.to(aev_computer.device)
coordinates = coordinates.to(model.aev_computer.device)
energies = energies.to(model.aev_computer.device)
a.add(*evaluate(coordinates, energies, _species))
mse = a.avg()
optimizer.zero_grad()
......@@ -59,7 +57,8 @@ def compute(chunk_size, batch_chunks):
agsqr.add(1, g**2)
ag = ag.avg()
agsqr = agsqr.avg()
with open('data/avg-{}-{}.dat'.format(chunk_size, batch_chunks), 'wb') as f:
filename = 'data/avg-{}-{}.dat'.format(chunk_size, batch_chunks)
with open(filename, 'wb') as f:
pickle.dump((ag, agsqr), f)
......
import torchani
import torch
import os
from configs import benchmark, device
import configs
class Averager:
......@@ -18,17 +18,15 @@ class Averager:
return self.subtotal / self.count
aev_computer = torchani.SortedAEV(benchmark=benchmark, device=device)
def celu(x, alpha):
return torch.where(x > 0, x, alpha * (torch.exp(x/alpha)-1))
class AtomicNetwork(torch.nn.Module):
def __init__(self):
def __init__(self, aev_computer):
super(AtomicNetwork, self).__init__()
self.aev_computer = aev_computer
self.output_length = 1
self.layer1 = torch.nn.Linear(384, 128).type(
aev_computer.dtype).to(aev_computer.device)
......@@ -51,16 +49,17 @@ class AtomicNetwork(torch.nn.Module):
return y
def get_or_create_model(filename):
def get_or_create_model(filename, benchmark=False, device=configs.device):
aev_computer = torchani.SortedAEV(benchmark=benchmark, device=device)
model = torchani.ModelOnAEV(
aev_computer,
reducer=torch.sum,
benchmark=benchmark,
per_species={
'C': AtomicNetwork(),
'H': AtomicNetwork(),
'N': AtomicNetwork(),
'O': AtomicNetwork(),
'C': AtomicNetwork(aev_computer),
'H': AtomicNetwork(aev_computer),
'N': AtomicNetwork(aev_computer),
'O': AtomicNetwork(aev_computer),
})
if os.path.isfile(filename):
model.load_state_dict(torch.load(filename))
......
import torch
benchmark = False
data_path = 'data/ANI-1x_complete.h5'
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
# flake8: noqa
import torch
import torchani
......
......@@ -2,18 +2,17 @@ import torch
import torchani
import torchani.data
import tqdm
import math
import timeit
import configs
import functools
configs.benchmark = True
from common import *
from common import get_or_create_model, Averager, evaluate
ds = torchani.data.load_dataset(configs.data_path)
sampler = torchani.data.BatchSampler(ds, 256, 4)
dataloader = torch.utils.data.DataLoader(
ds, batch_sampler=sampler, collate_fn=torchani.data.collate, num_workers=20)
model = get_or_create_model('/tmp/model.pt')
ds, batch_sampler=sampler,
collate_fn=torchani.data.collate, num_workers=20)
model = get_or_create_model('/tmp/model.pt', True)
optimizer = torch.optim.Adam(model.parameters(), amsgrad=True)
......@@ -47,20 +46,20 @@ for batch in tqdm.tqdm(dataloader, total=len(sampler)):
for molecule_id in batch:
_species = ds.species[molecule_id]
coordinates, energies = batch[molecule_id]
coordinates = coordinates.to(aev_computer.device)
energies = energies.to(aev_computer.device)
coordinates = coordinates.to(model.aev_computer.device)
energies = energies.to(model.aev_computer.device)
a.add(*evaluate(model, coordinates, energies, _species))
optimize_step(a)
elapsed = round(timeit.default_timer() - start, 2)
print('Radial terms:', aev_computer.timers['radial terms'])
print('Angular terms:', aev_computer.timers['angular terms'])
print('Terms and indices:', aev_computer.timers['terms and indices'])
print('Combinations:', aev_computer.timers['combinations'])
print('Mask R:', aev_computer.timers['mask_r'])
print('Mask A:', aev_computer.timers['mask_a'])
print('Assemble:', aev_computer.timers['assemble'])
print('Total AEV:', aev_computer.timers['total'])
print('Radial terms:', model.aev_computer.timers['radial terms'])
print('Angular terms:', model.aev_computer.timers['angular terms'])
print('Terms and indices:', model.aev_computer.timers['terms and indices'])
print('Combinations:', model.aev_computer.timers['combinations'])
print('Mask R:', model.aev_computer.timers['mask_r'])
print('Mask A:', model.aev_computer.timers['mask_a'])
print('Assemble:', model.aev_computer.timers['assemble'])
print('Total AEV:', model.aev_computer.timers['total'])
print('NN:', model.timers['nn'])
print('Total Forward:', model.timers['forward'])
print('Total Backward:', timer['backward'])
......
import torch
import numpy
import torchani
import unittest
import os
......@@ -15,7 +14,8 @@ class TestAEV(unittest.TestCase):
self.aev = torchani.SortedAEV(dtype=dtype, device=torch.device('cpu'))
self.tolerance = 1e-5
def _test_molecule(self, coordinates, species, expected_radial, expected_angular):
def _test_molecule(self, coordinates, species, expected_radial,
expected_angular):
radial, angular = self.aev(coordinates, species)
radial_diff = expected_radial - radial
radial_max_error = torch.max(torch.abs(radial_diff)).item()
......
......@@ -6,7 +6,8 @@ import copy
class TestBenchmark(unittest.TestCase):
def setUp(self, dtype=torchani.default_dtype, device=torchani.default_device):
def setUp(self, dtype=torchani.default_dtype,
device=torchani.default_device):
self.dtype = dtype
self.device = device
self.conformations = 100
......
import torchani
import unittest
import copy
import tempfile
import os
import torch
......@@ -28,7 +27,8 @@ class TestDataset(unittest.TestCase):
l2 = 0
for f in os.listdir(self.data_path):
f = os.path.join(self.data_path, f)
if os.path.isfile(f) and (f.endswith('.h5') or f.endswith('.hdf5')):
if os.path.isfile(f) and \
(f.endswith('.h5') or f.endswith('.hdf5')):
for j in pyanitools.anidataloader(f):
l2 += j['energies'].shape[0]
# compute data length using iterator
......@@ -46,7 +46,8 @@ class TestDataset(unittest.TestCase):
l2 = 0
for f in os.listdir(self.data_path):
f = os.path.join(self.data_path, f)
if os.path.isfile(f) and (f.endswith('.h5') or f.endswith('.hdf5')):
if os.path.isfile(f) and \
(f.endswith('.h5') or f.endswith('.hdf5')):
for j in pyanitools.anidataloader(f):
conformations = j['energies'].shape[0]
l2 += ceil(conformations / chunksize)
......@@ -102,12 +103,12 @@ class TestDataset(unittest.TestCase):
def _testMolSizes(self, ds):
for i in range(len(ds)):
l = bisect(ds.cumulative_sizes, i)
left = bisect(ds.cumulative_sizes, i)
moli = ds[i][0].item()
for j in range(len(ds)):
l2 = bisect(ds.cumulative_sizes, j)
left2 = bisect(ds.cumulative_sizes, j)
molj = ds[j][0].item()
if l == l2:
if left == left2:
self.assertEqual(moli, molj)
else:
if moli == molj:
......
import torch
import numpy
import torchani
import unittest
import os
......@@ -12,7 +11,8 @@ N = 97
class TestEnergies(unittest.TestCase):
def setUp(self, dtype=torchani.default_dtype, device=torchani.default_device):
def setUp(self, dtype=torchani.default_dtype,
device=torchani.default_device):
self.tolerance = 5e-5
self.aev_computer = torchani.SortedAEV(
dtype=dtype, device=torch.device('cpu'))
......
import torch
import numpy
import torchani
import unittest
import os
......@@ -11,7 +10,8 @@ N = 97
class TestForce(unittest.TestCase):
def setUp(self, dtype=torchani.default_dtype, device=torchani.default_device):
def setUp(self, dtype=torchani.default_dtype,
device=torchani.default_device):
self.tolerance = 1e-5
self.aev_computer = torchani.SortedAEV(
dtype=dtype, device=torch.device('cpu'))
......
Markdown is supported
0% or .
You are about to add 0 people to the discussion. Proceed with caution.
Finish editing this message first!
Please register or to comment