# DGL-LifeSci [Documentation](https://lifesci.dgl.ai/index.html) | [Discussion Forum](https://discuss.dgl.ai) ## Introduction Deep learning on graphs has been an arising trend in the past few years. There are a lot of graphs in life science such as molecular graphs and biological networks, making it an import area for applying deep learning on graphs. DGL-LifeSci is a DGL-based package for various applications in life science with graph neural networks. We provide various functionalities, including but not limited to methods for graph construction, featurization, and evaluation, model architectures, training scripts and pre-trained models. For a list of community contributors, see [here](CONTRIBUTORS.md). **For a full list of work implemented in DGL-LifeSci, see [here](examples/README.md).** ## Installation ### Requirements DGL-LifeSci should work on * all Linux distributions no earlier than Ubuntu 16.04 * macOS X * Windows 10 DGL-LifeSci requires python 3.6+, DGL 0.4.3+ and PyTorch 1.2.0+. Additionally, we require `RDKit 2018.09.3` for cheminformatics. We recommend installing it with ``` conda install -c conda-forge rdkit==2018.09.3 ``` For other installation recipes for RDKit, see the [official documentation](https://www.rdkit.org/docs/Install.html). ### Pip installation for DGL-LifeSci ``` pip install dgllife ``` ### Conda installation for DGL-LifeSci ``` conda install -c dglteam dgllife ``` ### Installation from source If you want to try experimental features, you can install from source as follows: ``` git clone https://github.com/dmlc/dgl.git cd apps/life_sci/python python setup.py install ``` ### Verifying successful installation Once you have installed the package, you can verify the success of installation with ```python import dgllife print(dgllife.__version__) # 0.2.2 ``` If you are new to DGL, the first time you import dgl a message will pop up as below: ``` DGL does not detect a valid backend option. Which backend would you like to work with? Backend choice (pytorch, mxnet or tensorflow): ``` and you need to enter `pytorch`. ## Example Usage To apply graph neural networks to molecules with DGL, we need to first construct `DGLGraph` -- the graph data structure in DGL and prepare initial node/edge features. Below gives an example of constructing a bi-directed graph from a molecule and featurizing it with atom and bond features such as atom type and bond type. ```python from dgllife.utils import smiles_to_bigraph, CanonicalAtomFeaturizer, CanonicalBondFeaturizer # Node featurizer node_featurizer = CanonicalAtomFeaturizer(atom_data_field='h') # Edge featurizer edge_featurizer = CanonicalBondFeaturizer(bond_data_field='h') # SMILES (a string representation for molecule) for Penicillin smiles = 'CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C' g = smiles_to_bigraph(smiles=smiles, node_featurizer=node_featurizer, edge_featurizer=edge_featurizer) print(g) """ DGLGraph(num_nodes=23, num_edges=50, ndata_schemes={'h': Scheme(shape=(74,), dtype=torch.float32)} edata_schemes={'h': Scheme(shape=(12,), dtype=torch.float32)}) """ ``` We implement various models that users can import directly. Below gives an example of defining a GCN-based model for molecular property prediction. ```python from dgllife.model import GCNPredictor model = GCNPredictor(in_feats=1) ``` For a full example of applying `GCNPredictor`, run the following command ```bash python examples/property_prediction/classification.py -m GCN -d Tox21 ``` For more examples on molecular property prediction, generative models, protein-ligand binding affinity prediction and reaction prediction, see `examples`. We also provide pre-trained models for most examples, which can be used off-shelf without training from scratch. Below gives an example of loading a pre-trained model for `GCNPredictor` on a molecular property prediction dataset. ```python from dgllife.data import Tox21 from dgllife.model import load_pretrained from dgllife.utils import smiles_to_bigraph, CanonicalAtomFeaturizer dataset = Tox21(smiles_to_bigraph, CanonicalAtomFeaturizer()) model = load_pretrained('GCN_Tox21') # Pretrained model loaded model.eval() smiles, g, label, mask = dataset[0] feats = g.ndata.pop('h') label_pred = model(g, feats) print(smiles) # CCOc1ccc2nc(S(N)(=O)=O)sc2c1 print(label_pred[:, mask != 0]) # Mask non-existing labels # tensor([[ 1.4190, -0.1820, 1.2974, 1.4416, 0.6914, # 2.0957, 0.5919, 0.7715, 1.7273, 0.2070]]) ``` Similarly, we can load a pre-trained model for generating molecules. If possible, we recommend running the code block below with Jupyter notebook. ```python from dgllife.model import load_pretrained model = load_pretrained('DGMG_ZINC_canonical') model.eval() smiles = [] for i in range(4): smiles.append(model(rdkit_mol=True)) print(smiles) # ['CC1CCC2C(CCC3C2C(NC2=CC(Cl)=CC=C2N)S3(=O)=O)O1', # 'O=C1SC2N=CN=C(NC(SC3=CC=CC=N3)C1=CC=CO)C=2C1=CCCC1', # 'CC1C=CC(=CC=1)C(=O)NN=C(C)C1=CC=CC2=CC=CC=C21', # 'CCN(CC1=CC=CC=C1F)CC1CCCN(C)C1'] ``` If you are running the code block above in Jupyter notebook, you can also visualize the molecules generated with ```python from IPython.display import SVG from rdkit import Chem from rdkit.Chem import Draw mols = [Chem.MolFromSmiles(s) for s in smiles] SVG(Draw.MolsToGridImage(mols, molsPerRow=4, subImgSize=(180, 150), useSVG=True)) ``` ![](https://data.dgl.ai/dgllife/dgmg/dgmg_model_zoo_example2.png) ## Speed Reference Below we provide some reference numbers to show how DGL improves the speed of training models per epoch in seconds. | Model | Original Implementation | DGL Implementation | Improvement | | ---------------------------------- | ----------------------- | -------------------------- | ---------------------------- | | GCN on Tox21 | 5.5 (DeepChem) | 1.0 | 5.5x | | AttentiveFP on Aromaticity | 6.0 | 1.2 | 5x | | JTNN on ZINC | 1826 | 743 | 2.5x | | WLN for reaction center prediction | 11657 | 858 (1 GPU) / 134 (8 GPUs) | 13.6x (1GPU) / 87.0x (8GPUs) | | WLN for candidate ranking | 40122 | 22268 | 1.8x |